C19H28ClN3O6S — CID 16521865
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 16521865) has the molecular formula C19H28ClN3O6S and a molecular weight of 461.97 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16521865 |
| Molecular Formula | C19H28ClN3O6S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)NC(=O)NCCC(C)C)ccc1Cl |
| InChI | InChI=1S/C19H28ClN3O6S/c1-5-23(6-2)30(27,28)16-11-14(7-8-15(16)20)18(25)29-12-17(24)22-19(26)21-10-9-13(3)4/h7-8,11,13H,5-6,9-10,12H2,1-4H3,(H2,21,22,24,26) |
| InChIKey | MSEGBBAYHFMYME-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |