C14H18ClN3O6S — CID 2615149
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2615149) has the molecular formula C14H18ClN3O6S and a molecular weight of 391.83 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2615149 |
| Molecular Formula | C14H18ClN3O6S |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H18ClN3O6S/c1-8(2)6-17-14(21)18-12(19)7-24-13(20)9-3-4-10(15)11(5-9)25(16,22)23/h3-5,8H,6-7H2,1-2H3,(H2,16,22,23)(H2,17,18,19,21) |
| InChIKey | JVIMEJSCYMWLCV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |