C13H15Cl2N3O4 — CID 8021673
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021673) has the molecular formula C13H15Cl2N3O4 and a molecular weight of 348.19 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021673 |
| Molecular Formula | C13H15Cl2N3O4 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O4/c1-7(2)4-17-13(21)18-10(19)6-22-12(20)8-3-9(14)11(15)16-5-8/h3,5,7H,4,6H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | OSHGCWGBQNBRHK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|