C18H14Cl2N2O4 — CID 9231041
[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 9231041) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9231041 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H14Cl2N2O4/c1-10(15-7-11-4-2-3-5-14(11)26-15)22-16(23)9-25-18(24)12-6-13(19)17(20)21-8-12/h2-8,10H,9H2,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | SLZHZXSJRBLKPQ-JTQLQIEISA-N |
| XLogP | 4.17 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|