C18H15Cl2NO3 — CID 8578495
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 8578495) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 8578495 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | C[C@H](NC(=O)COc1cc(Cl)ccc1Cl)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-11(16-8-12-4-2-3-5-15(12)24-16)21-18(22)10-23-17-9-13(19)6-7-14(17)20/h2-9,11H,10H2,1H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | PMKSOFIXFVNDCV-NSHDSACASA-N |
| XLogP | 5.00 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |