C19H16ClNO4 — CID 9014368
[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 9014368) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 9014368 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cccc(Cl)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H16ClNO4/c1-12(17-10-13-5-2-3-8-16(13)25-17)21-18(22)11-24-19(23)14-6-4-7-15(20)9-14/h2-10,12H,11H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | MLXFMPWBUNUEBQ-LBPRGKRZSA-N |
| XLogP | 4.12 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |