C19H16ClNO5 — CID 9286406
[2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 9286406) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 9286406 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cc(Cl)ccc1O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H16ClNO5/c1-11(17-8-12-4-2-3-5-16(12)26-17)21-18(23)10-25-19(24)14-9-13(20)6-7-15(14)22/h2-9,11,22H,10H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | FFQSXPMRTCJKHH-NSHDSACASA-N |
| XLogP | 3.83 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |