C19H18ClN3O3 — CID 18268262
2-[(Z)-[amino-(4-chlorophenyl)methylidene]amino]oxy-N-[1-(1-benzofuran-2-yl)ethyl]acetamide (PubChem CID 18268262) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-[(Z)-[amino-(4-chlorophenyl)methylidene]amino]oxy-N-[1-(1-benzofuran-2-yl)ethyl]acetamide.
| Compound Name | 2-[(Z)-[amino-(4-chlorophenyl)methylidene]amino]oxy-N-[1-(1-benzofuran-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 18268262 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[(Z)-[amino-(4-chlorophenyl)methylidene]amino]oxy-N-[1-(1-benzofuran-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CO/N=C(\N)c1ccc(Cl)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-12(17-10-14-4-2-3-5-16(14)26-17)22-18(24)11-25-23-19(21)13-6-8-15(20)9-7-13/h2-10,12H,11H2,1H3,(H2,21,23)(H,22,24) |
| InChIKey | WIUCYBLWJYFSRB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|