C20H19NO5 — CID 8581736
[2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate (PubChem CID 8581736) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 8581736 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-[[(1R)-1-(1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N[C@H](C)c2cc3ccccc3o2)c(O)c1 |
| InChI | InChI=1S/C20H19NO5/c1-12-7-8-15(16(22)9-12)20(24)25-11-19(23)21-13(2)18-10-14-5-3-4-6-17(14)26-18/h3-10,13,22H,11H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | ACNNYJATLPXSRG-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |