C21H18ClNO3 — CID 55397519
[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-chlorobenzoate (PubChem CID 55397519) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 55397519 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 3-chlorobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cccc(Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18ClNO3/c1-14(18-11-5-7-15-6-2-3-10-19(15)18)23-20(24)13-26-21(25)16-8-4-9-17(22)12-16/h2-12,14H,13H2,1H3,(H,23,24) |
| InChIKey | NLWJNNIRSCELAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |