C10H9Cl2N3O4 — CID 9231039
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 9231039) has the molecular formula C10H9Cl2N3O4 and a molecular weight of 306.11 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9231039 |
| Molecular Formula | C10H9Cl2N3O4 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | NC(=O)CNC(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N3O4/c11-6-1-5(2-15-9(6)12)10(18)19-4-8(17)14-3-7(13)16/h1-2H,3-4H2,(H2,13,16)(H,14,17) |
| InChIKey | SWQZUQVWBSWUSE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|