C11H10Cl2N2O5 — CID 8021617
[2-(ethoxycarbonylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021617) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021617 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O5/c1-2-19-11(18)15-8(16)5-20-10(17)6-3-7(12)9(13)14-4-6/h3-4H,2,5H2,1H3,(H,15,16,18) |
| InChIKey | MIFIFXZTDOKEBW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|