C15H18Cl2N2O5 — CID 55397258
[2-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 55397258) has the molecular formula C15H18Cl2N2O5 and a molecular weight of 377.22 g/mol. Its IUPAC name is [2-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55397258 |
| Molecular Formula | C15H18Cl2N2O5 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [2-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2O5/c1-8(2)4-11(15(22)23-3)19-12(20)7-24-14(21)9-5-10(16)13(17)18-6-9/h5-6,8,11H,4,7H2,1-3H3,(H,19,20) |
| InChIKey | JUCSCJBYYPRXEQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|