C20H24Cl2N2O3 — CID 8021591
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8021591) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8021591 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24Cl2N2O3/c1-11(20-6-12-2-13(7-20)4-14(3-12)8-20)24-17(25)10-27-19(26)15-5-16(21)18(22)23-9-15/h5,9,11-14H,2-4,6-8,10H2,1H3,(H,24,25)/t11-,12?,13?,14?,20?/m1/s1 |
| InChIKey | HCTWBDKTQCKPHR-JIEKGTPASA-N |
| XLogP | 4.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|