C21H26BrNO3 — CID 7662984
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-bromobenzoate (PubChem CID 7662984) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-bromobenzoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 7662984 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-bromobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cccc(Br)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26BrNO3/c1-13(21-9-14-5-15(10-21)7-16(6-14)11-21)23-19(24)12-26-20(25)17-3-2-4-18(22)8-17/h2-4,8,13-16H,5-7,9-12H2,1H3,(H,23,24)/t13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | CDDMCONLNCFJHR-BUBBNXEVSA-N |
| XLogP | 4.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |