C23H31NO4S — CID 11916300
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate (PubChem CID 11916300) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11916300 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
| SMILES | CC[S@@](=O)c1ccccc1C(=O)OCC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO4S/c1-3-29(27)20-7-5-4-6-19(20)22(26)28-14-21(25)24-15(2)23-11-16-8-17(12-23)10-18(9-16)13-23/h4-7,15-18H,3,8-14H2,1-2H3,(H,24,25)/t15-,16?,17?,18?,23?,29+/m0/s1 |
| InChIKey | XMCXWDUZENERIF-RTJQQNNDSA-N |
| XLogP | 3.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |