C22H26F3NO3 — CID 7859807
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 7859807) has the molecular formula C22H26F3NO3 and a molecular weight of 409.45 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7859807 |
| Molecular Formula | C22H26F3NO3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccccc1C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26F3NO3/c1-13(21-9-14-6-15(10-21)8-16(7-14)11-21)26-19(27)12-29-20(28)17-4-2-3-5-18(17)22(23,24)25/h2-5,13-16H,6-12H2,1H3,(H,26,27)/t13-,14?,15?,16?,21?/m0/s1 |
| InChIKey | JHAXPYABIZHLSX-JHMRYYBSSA-N |
| XLogP | 4.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |