C23H31NO3 — CID 7796052
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 7796052) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7796052 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C23H31NO3/c1-14-4-5-20(15(2)6-14)22(26)27-13-21(25)24-16(3)23-10-17-7-18(11-23)9-19(8-17)12-23/h4-6,16-19H,7-13H2,1-3H3,(H,24,25)/t16-,17?,18?,19?,23?/m1/s1 |
| InChIKey | QCHQJOWSKLQMNH-DNBYOKIBSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |