C25H35NO5 — CID 7785741
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 7785741) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 7785741 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)cc1OCC |
| InChI | InChI=1S/C25H35NO5/c1-4-29-21-7-6-20(11-22(21)30-5-2)24(28)31-15-23(27)26-16(3)25-12-17-8-18(13-25)10-19(9-17)14-25/h6-7,11,16-19H,4-5,8-10,12-15H2,1-3H3,(H,26,27)/t16-,17?,18?,19?,25?/m1/s1 |
| InChIKey | UXDSLIGIIGAJHU-ASXFNGKXSA-N |
| XLogP | 4.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |