C23H31NO4 — CID 8009776
N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-ethoxy-4-formylphenoxy)acetamide (PubChem CID 8009776) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-ethoxy-4-formylphenoxy)acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-ethoxy-4-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 8009776 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-ethoxy-4-formylphenoxy)acetamide |
| SMILES | CCOc1cc(C=O)ccc1OCC(=O)N[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO4/c1-3-27-21-9-16(13-25)4-5-20(21)28-14-22(26)24-15(2)23-10-17-6-18(11-23)8-19(7-17)12-23/h4-5,9,13,15,17-19H,3,6-8,10-12,14H2,1-2H3,(H,24,26)/t15-,17?,18?,19?,23?/m1/s1 |
| InChIKey | CVXUXKPNAJKYRE-MBAYWBQQSA-N |
| XLogP | 4.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|