C20H25NO4 — CID 7611574
N-(1-adamantyl)-2-(5-formyl-2-methoxyphenoxy)acetamide (PubChem CID 7611574) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(5-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-(1-adamantyl)-2-(5-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7611574 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-(1-adamantyl)-2-(5-formyl-2-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25NO4/c1-24-17-3-2-13(11-22)7-18(17)25-12-19(23)21-20-8-14-4-15(9-20)6-16(5-14)10-20/h2-3,7,11,14-16H,4-6,8-10,12H2,1H3,(H,21,23) |
| InChIKey | UXBKWKYIAMUYCB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|