C20H23NO6 — CID 7611948
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-formyl-2-methoxyphenoxy)acetamide (PubChem CID 7611948) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7611948 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-formyl-2-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2cc(C=O)ccc2OC)cc1OC |
| InChI | InChI=1S/C20H23NO6/c1-24-16-6-4-14(10-18(16)26-3)8-9-21-20(23)13-27-19-11-15(12-22)5-7-17(19)25-2/h4-7,10-12H,8-9,13H2,1-3H3,(H,21,23) |
| InChIKey | OYGGOAJWOBXTOK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|