C21H25NO7 — CID 36545646
2-(2-ethoxy-4-formylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 36545646) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(2-ethoxy-4-formylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-ethoxy-4-formylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 36545646 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(2-ethoxy-4-formylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1cc(C=O)ccc1OCC(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H25NO7/c1-5-28-17-8-14(12-23)6-7-16(17)29-13-20(24)22-11-15-9-18(25-2)21(27-4)19(10-15)26-3/h6-10,12H,5,11,13H2,1-4H3,(H,22,24) |
| InChIKey | DQTVWULOLLSSRE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|