C14H18N2O5 — CID 9480867
2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide (PubChem CID 9480867) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9480867 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[[2-(4-formyl-2-methoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1cc(C=O)ccc1OCC(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C14H18N2O5/c1-16(2)14(19)7-15-13(18)9-21-11-5-4-10(8-17)6-12(11)20-3/h4-6,8H,7,9H2,1-3H3,(H,15,18) |
| InChIKey | HUWIZKXLAQTXCH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|