C13H17NO4 — CID 62326485
N-ethyl-3-(4-formyl-2-methoxyphenoxy)propanamide (PubChem CID 62326485) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-ethyl-3-(4-formyl-2-methoxyphenoxy)propanamide.
| Compound Name | N-ethyl-3-(4-formyl-2-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 62326485 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-ethyl-3-(4-formyl-2-methoxyphenoxy)propanamide |
| SMILES | CCNC(=O)CCOc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C13H17NO4/c1-3-14-13(16)6-7-18-11-5-4-10(9-15)8-12(11)17-2/h4-5,8-9H,3,6-7H2,1-2H3,(H,14,16) |
| InChIKey | SBFBINXXXVKHQC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|