C16H22N2O5 — CID 9201158
2-[[2-(2-ethoxy-4-formylphenoxy)acetyl]amino]-N-propylacetamide (PubChem CID 9201158) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[2-(2-ethoxy-4-formylphenoxy)acetyl]amino]-N-propylacetamide.
| Compound Name | 2-[[2-(2-ethoxy-4-formylphenoxy)acetyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 9201158 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[[2-(2-ethoxy-4-formylphenoxy)acetyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(=O)COc1ccc(C=O)cc1OCC |
| InChI | InChI=1S/C16H22N2O5/c1-3-7-17-15(20)9-18-16(21)11-23-13-6-5-12(10-19)8-14(13)22-4-2/h5-6,8,10H,3-4,7,9,11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | AFEZBBADGOLTAN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|