C17H16ClNO4 — CID 1156887
N-(4-chlorophenyl)-2-(2-ethoxy-4-formylphenoxy)acetamide (PubChem CID 1156887) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-ethoxy-4-formylphenoxy)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(2-ethoxy-4-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 1156887 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-ethoxy-4-formylphenoxy)acetamide |
| SMILES | CCOc1cc(C=O)ccc1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO4/c1-2-22-16-9-12(10-20)3-8-15(16)23-11-17(21)19-14-6-4-13(18)5-7-14/h3-10H,2,11H2,1H3,(H,19,21) |
| InChIKey | IOEQAQQPDFEJNP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|