C16H13ClFNO4 — CID 7611560
N-(3-chloro-4-fluorophenyl)-2-(5-formyl-2-methoxyphenoxy)acetamide (PubChem CID 7611560) has the molecular formula C16H13ClFNO4 and a molecular weight of 337.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(5-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(5-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7611560 |
| Molecular Formula | C16H13ClFNO4 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(5-formyl-2-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClFNO4/c1-22-14-5-2-10(8-20)6-15(14)23-9-16(21)19-11-3-4-13(18)12(17)7-11/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | ZJLRJRYFAUOBEL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|