C15H11ClFNO3 — CID 17202080
N-(3-chloro-4-fluorophenyl)-2-(3-formylphenoxy)acetamide (PubChem CID 17202080) has the molecular formula C15H11ClFNO3 and a molecular weight of 307.71 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(3-formylphenoxy)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(3-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 17202080 |
| Molecular Formula | C15H11ClFNO3 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(3-formylphenoxy)acetamide |
| SMILES | O=Cc1cccc(OCC(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C15H11ClFNO3/c16-13-7-11(4-5-14(13)17)18-15(20)9-21-12-3-1-2-10(6-12)8-19/h1-8H,9H2,(H,18,20) |
| InChIKey | SDURXMLNAZXTPL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|