C21H22ClFN4O4 — CID 126181524
N'-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 126181524) has the molecular formula C21H22ClFN4O4 and a molecular weight of 448.88 g/mol. Its IUPAC name is N'-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 126181524 |
| Molecular Formula | C21H22ClFN4O4 |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N'-[(Z)-[3-[2-(3-chloro-4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | CC(C)CNC(=O)C(=O)N/N=C\c1cccc(OCC(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H22ClFN4O4/c1-13(2)10-24-20(29)21(30)27-25-11-14-4-3-5-16(8-14)31-12-19(28)26-15-6-7-18(23)17(22)9-15/h3-9,11,13H,10,12H2,1-2H3,(H,24,29)(H,26,28)(H,27,30)/b25-11- |
| InChIKey | ZIQQIFGPZGHWCG-GATIEOLUSA-N |
| XLogP | 2.72 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|