C15H14ClNO4S — CID 78899642
N-[(5-chlorothiophen-2-yl)methyl]-2-(5-formyl-2-methoxyphenoxy)acetamide (PubChem CID 78899642) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(5-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(5-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 78899642 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(5-formyl-2-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-20-12-4-2-10(8-18)6-13(12)21-9-15(19)17-7-11-3-5-14(16)22-11/h2-6,8H,7,9H2,1H3,(H,17,19) |
| InChIKey | AMVDLQZQCMCIJN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|