C15H16ClNO3S — CID 110767682
2-(5-chlorothiophen-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 110767682) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 110767682 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)Cc2ccc(Cl)s2)cc1OC |
| InChI | InChI=1S/C15H16ClNO3S/c1-19-12-5-3-10(7-13(12)20-2)9-17-15(18)8-11-4-6-14(16)21-11/h3-7H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | JWEXJJOHSUZICI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |