C15H18N2O3 — CID 110769143
N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-pyrrol-3-yl)acetamide (PubChem CID 110769143) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-pyrrol-3-yl)acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-pyrrol-3-yl)acetamide |
|---|---|
| PubChem CID | 110769143 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(1H-pyrrol-3-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)Cc2cc[nH]c2)cc1OC |
| InChI | InChI=1S/C15H18N2O3/c1-19-13-4-3-11(7-14(13)20-2)10-17-15(18)8-12-5-6-16-9-12/h3-7,9,16H,8,10H2,1-2H3,(H,17,18) |
| InChIKey | UIQALOMJRFVMRN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |