C17H18ClNO3 — CID 9242490
2-(2-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 9242490) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9242490 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C17H18ClNO3/c1-21-15-8-7-12(9-16(15)22-2)11-19-17(20)10-13-5-3-4-6-14(13)18/h3-9H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | YVWOJPHDGGMRLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |