C20H24ClNO3S — CID 4988113
3-[(2-chlorophenyl)methylsulfanyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]propanamide (PubChem CID 4988113) has the molecular formula C20H24ClNO3S and a molecular weight of 393.94 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylsulfanyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(2-chlorophenyl)methylsulfanyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 4988113 |
| Molecular Formula | C20H24ClNO3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[(2-chlorophenyl)methylsulfanyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]propanamide |
| SMILES | CCOc1ccc(CNC(=O)CCSCc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C20H24ClNO3S/c1-3-25-18-9-8-15(12-19(18)24-2)13-22-20(23)10-11-26-14-16-6-4-5-7-17(16)21/h4-9,12H,3,10-11,13-14H2,1-2H3,(H,22,23) |
| InChIKey | WVTAWGFHNQWGPM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|