C18H19Cl2NO4 — CID 55660605
2-(3,4-dichlorophenoxy)-N-[(4-ethoxy-3-methoxyphenyl)methyl]acetamide (PubChem CID 55660605) has the molecular formula C18H19Cl2NO4 and a molecular weight of 384.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-[(4-ethoxy-3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-[(4-ethoxy-3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55660605 |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-[(4-ethoxy-3-methoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccc(CNC(=O)COc2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO4/c1-3-24-16-7-4-12(8-17(16)23-2)10-21-18(22)11-25-13-5-6-14(19)15(20)9-13/h4-9H,3,10-11H2,1-2H3,(H,21,22) |
| InChIKey | WRLFMALICSVGFH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |