C22H21ClN2O4 — CID 47042624
2-(4-chlorophenoxy)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide (PubChem CID 47042624) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 47042624 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)COc2ccc(Cl)cc2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-27-21-12-17(2-7-20(21)29-14-16-8-10-24-11-9-16)13-25-22(26)15-28-19-5-3-18(23)4-6-19/h2-12H,13-15H2,1H3,(H,25,26) |
| InChIKey | DNRKAJSSAUIXGL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |