C27H31N3O5 — CID 55843425
4-butoxy-N-[2-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methylamino]-2-oxoethyl]benzamide (PubChem CID 55843425) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55843425 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 4-butoxy-N-[2-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methylamino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NCc2ccc(OCc3ccncc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H31N3O5/c1-3-4-15-34-23-8-6-22(7-9-23)27(32)30-18-26(31)29-17-21-5-10-24(25(16-21)33-2)35-19-20-11-13-28-14-12-20/h5-14,16H,3-4,15,17-19H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | QVUODXSJUJKHCK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|