C24H33NO4 — CID 54776997
4-hexoxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzamide (PubChem CID 54776997) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 4-hexoxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzamide.
| Compound Name | 4-hexoxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 54776997 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 4-hexoxy-N-[(3-methoxy-4-propoxyphenyl)methyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NCc2ccc(OCCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H33NO4/c1-4-6-7-8-16-28-21-12-10-20(11-13-21)24(26)25-18-19-9-14-22(29-15-5-2)23(17-19)27-3/h9-14,17H,4-8,15-16,18H2,1-3H3,(H,25,26) |
| InChIKey | PIEFPHAMNROKRM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|