C25H34N2O5 — CID 55632481
4-ethoxy-N-[1-[(3-methoxy-4-propoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 55632481) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-ethoxy-N-[1-[(3-methoxy-4-propoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-[(3-methoxy-4-propoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55632481 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 4-ethoxy-N-[1-[(3-methoxy-4-propoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCCOc1ccc(CNC(=O)C(NC(=O)c2ccc(OCC)cc2)C(C)C)cc1OC |
| InChI | InChI=1S/C25H34N2O5/c1-6-14-32-21-13-8-18(15-22(21)30-5)16-26-25(29)23(17(3)4)27-24(28)19-9-11-20(12-10-19)31-7-2/h8-13,15,17,23H,6-7,14,16H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | BBUWYLOWCAZKER-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |