C25H27NO4 — CID 27865748
2-(4-ethoxyphenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 27865748) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27865748 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NCc2ccc(OCc3ccccc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H27NO4/c1-3-29-22-12-9-19(10-13-22)16-25(27)26-17-21-11-14-23(24(15-21)28-2)30-18-20-7-5-4-6-8-20/h4-15H,3,16-18H2,1-2H3,(H,26,27) |
| InChIKey | YMHFQHBYGSTKSO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |