C22H23N3O6S — CID 55843428
N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]-4-(methoxysulfamoyl)benzamide (PubChem CID 55843428) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]-4-(methoxysulfamoyl)benzamide.
| Compound Name | N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]-4-(methoxysulfamoyl)benzamide |
|---|---|
| PubChem CID | 55843428 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]-4-(methoxysulfamoyl)benzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)NCc2ccc(OCc3ccncc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-29-21-13-17(3-8-20(21)31-15-16-9-11-23-12-10-16)14-24-22(26)18-4-6-19(7-5-18)32(27,28)25-30-2/h3-13,25H,14-15H2,1-2H3,(H,24,26) |
| InChIKey | OSYCEWGUHTZLPO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|