C21H22ClN2O2+ — CID 7228193
[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(pyridin-4-ylmethyl)azanium (PubChem CID 7228193) has the molecular formula C21H22ClN2O2+ and a molecular weight of 369.87 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(pyridin-4-ylmethyl)azanium.
| Compound Name | [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(pyridin-4-ylmethyl)azanium |
|---|---|
| PubChem CID | 7228193 |
| Molecular Formula | C21H22ClN2O2+ |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(pyridin-4-ylmethyl)azanium |
| SMILES | COc1cc(C[NH2+]Cc2ccncc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O2/c1-25-21-12-18(14-24-13-16-8-10-23-11-9-16)4-7-20(21)26-15-17-2-5-19(22)6-3-17/h2-12,24H,13-15H2,1H3/p+1 |
| InChIKey | WQKKJLNOWMZBOW-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |