C16H20ClN2O2+ — CID 7597481
[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-ethylazanium (PubChem CID 7597481) has the molecular formula C16H20ClN2O2+ and a molecular weight of 307.80 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-ethylazanium.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-ethylazanium |
|---|---|
| PubChem CID | 7597481 |
| Molecular Formula | C16H20ClN2O2+ |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-ethylazanium |
| SMILES | CC[NH2+]Cc1ccc(OCc2ccc(Cl)nc2)c(OC)c1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-3-18-9-12-4-6-14(15(8-12)20-2)21-11-13-5-7-16(17)19-10-13/h4-8,10,18H,3,9,11H2,1-2H3/p+1 |
| InChIKey | NXEKYOCXPXLAMJ-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|