C25H31Cl3N2O4 — CID 17055824
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;dihydrochloride (PubChem CID 17055824) has the molecular formula C25H31Cl3N2O4 and a molecular weight of 529.89 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;dihydrochloride.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17055824 |
| Molecular Formula | C25H31Cl3N2O4 |
| Molecular Weight | 529.89 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(OC)c(OC)c2)ccc1OCc1ccc(Cl)nc1.Cl.Cl |
| InChI | InChI=1S/C25H29ClN2O4.2ClH/c1-4-31-24-14-19(6-9-22(24)32-17-20-7-10-25(26)28-16-20)15-27-12-11-18-5-8-21(29-2)23(13-18)30-3;;/h5-10,13-14,16,27H,4,11-12,15,17H2,1-3H3;2*1H |
| InChIKey | LYBOEBWXWUXOBP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.89 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|