C15H16ClNO2 — CID 103866434
2-chloro-5-[(4-ethyl-2-methoxyphenoxy)methyl]pyridine (PubChem CID 103866434) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-chloro-5-[(4-ethyl-2-methoxyphenoxy)methyl]pyridine.
| Compound Name | 2-chloro-5-[(4-ethyl-2-methoxyphenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 103866434 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-chloro-5-[(4-ethyl-2-methoxyphenoxy)methyl]pyridine |
| SMILES | CCc1ccc(OCc2ccc(Cl)nc2)c(OC)c1 |
| InChI | InChI=1S/C15H16ClNO2/c1-3-11-4-6-13(14(8-11)18-2)19-10-12-5-7-15(16)17-9-12/h4-9H,3,10H2,1-2H3 |
| InChIKey | DBCQGIJPRXATCC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|