C20H26ClN2O2+ — CID 7600659
[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-cyclohexylazanium (PubChem CID 7600659) has the molecular formula C20H26ClN2O2+ and a molecular weight of 361.89 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-cyclohexylazanium.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-cyclohexylazanium |
|---|---|
| PubChem CID | 7600659 |
| Molecular Formula | C20H26ClN2O2+ |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-cyclohexylazanium |
| SMILES | COc1cc(C[NH2+]C2CCCCC2)ccc1OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H25ClN2O2/c1-24-19-11-15(12-22-17-5-3-2-4-6-17)7-9-18(19)25-14-16-8-10-20(21)23-13-16/h7-11,13,17,22H,2-6,12,14H2,1H3/p+1 |
| InChIKey | SYVLLAJNSBURQV-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|