C21H30ClN3O2+2 — CID 7247646
[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]azanium (PubChem CID 7247646) has the molecular formula C21H30ClN3O2+2 and a molecular weight of 391.94 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]azanium.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7247646 |
| Molecular Formula | C21H30ClN3O2+2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]azanium |
| SMILES | CC[NH+]1CCC[C@@H]1C[NH2+]Cc1ccc(OCc2ccc(Cl)nc2)c(OC)c1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-3-25-10-4-5-18(25)14-23-12-16-6-8-19(20(11-16)26-2)27-15-17-7-9-21(22)24-13-17/h6-9,11,13,18,23H,3-5,10,12,14-15H2,1-2H3/p+2/t18-/m1/s1 |
| InChIKey | DHNBZPCXCRPQPE-GOSISDBHSA-P |
| XLogP | 1.45 |
| TPSA | 52.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|