C19H23ClN2O3 — CID 7579610
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-[(2S)-oxolan-2-yl]methanamine (PubChem CID 7579610) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-[(2S)-oxolan-2-yl]methanamine.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-[(2S)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 7579610 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-1-[(2S)-oxolan-2-yl]methanamine |
| SMILES | COc1cc(CNC[C@@H]2CCCO2)ccc1OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-23-18-9-14(10-21-12-16-3-2-8-24-16)4-6-17(18)25-13-15-5-7-19(20)22-11-15/h4-7,9,11,16,21H,2-3,8,10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | DLUUWTKMGYQGRU-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|