C20H25ClN2O3 — CID 17055819
N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-(oxolan-2-yl)methanamine (PubChem CID 17055819) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-(oxolan-2-yl)methanamine.
| Compound Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 17055819 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[[4-[(6-chloro-3-pyridinyl)methoxy]-3-ethoxyphenyl]methyl]-1-(oxolan-2-yl)methanamine |
| SMILES | CCOc1cc(CNCC2CCCO2)ccc1OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-2-24-19-10-15(11-22-13-17-4-3-9-25-17)5-7-18(19)26-14-16-6-8-20(21)23-12-16/h5-8,10,12,17,22H,2-4,9,11,13-14H2,1H3 |
| InChIKey | FIIRJOFOLBTDJP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|